missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Mercury(II) Acetate, 99.99% Trace Metals Basis, Honeywell™
99.999% trace metals basis
174.80 € - 566.95 €
Chemical Identifiers
| CAS | 1600-27-7 |
|---|---|
| Molecular Formula | C4H6HgO4 |
| Molecular Weight (g/mol) | 318.68 |
| MDL Number | MFCD00012165 |
| InChI Key | BRMYZIKAHFEUFJ-UHFFFAOYSA-L |
| Synonym | mercury 2+ ion acetic acid |
| PubChem CID | 15337 |
| ChEBI | CHEBI:33211 |
| IUPAC Name | mercury(2+);diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Hg+2] |
Description
- We are your supplier of high-quality lab reagents and chemicals for analytical and chemistry laboratories:
Solvents – ACS specific use (HPLC), ACS general use, solvents for histology, and reagent grade for chemical synthesis and other industrial applications.
Inorganics – Chemical synthesis and inorganic chemistry including essential acids and bases, salts, metals and elements, and reagents for chemical reactions.
Chemical Identifiers
| 1600-27-7 | |
| 318.68 | |
| BRMYZIKAHFEUFJ-UHFFFAOYSA-L | |
| 15337 | |
| mercury(2+);diacetate |
| C4H6HgO4 | |
| MFCD00012165 | |
| mercury 2+ ion acetic acid | |
| CHEBI:33211 | |
| CC(=O)[O-].CC(=O)[O-].[Hg+2] |
Specifications
| 179°C to 182°C | |
| Beige | |
| (CH3COO)2Hg | |
| UN1629 | |
| mercury 2+ ion acetic acid | |
| CC(=O)[O-].CC(=O)[O-].[Hg+2] | |
| 318.68 | |
| CHEBI:33211 | |
| 99.999% (trace metals basis) | |
| 3.27g/cm3 |
| 1600-27-7 | |
| C4H6HgO4 | |
| MFCD00012165 | |
| 3563831 | |
| BRMYZIKAHFEUFJ-UHFFFAOYSA-L | |
| mercury(2+);diacetate | |
| 15337 | |
| 318.68g/mol | |
| Powder | |
| Mercury(II) acetate |
Safety and Handling
P260-P273-P280-P301 + P310 + P330-P302 + P352 + P310-P304 + P340 + P310
missing translation for 'dotInformation' : 6.1/PGII
missing translation for 'rtecsNumber' : 216-491-1